C19H34N4O3 — CID 23348617
1,3-bis[(2-oxoazonan-1-yl)methyl]urea (PubChem CID 23348617) has the molecular formula C19H34N4O3 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1,3-bis[(2-oxoazonan-1-yl)methyl]urea.
| Compound Name | 1,3-bis[(2-oxoazonan-1-yl)methyl]urea |
|---|---|
| PubChem CID | 23348617 |
| Molecular Formula | C19H34N4O3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 1,3-bis[(2-oxoazonan-1-yl)methyl]urea |
| SMILES | O=C(NCN1CCCCCCCC1=O)NCN1CCCCCCCC1=O |
| InChI | InChI=1S/C19H34N4O3/c24-17-11-7-3-1-5-9-13-22(17)15-20-19(26)21-16-23-14-10-6-2-4-8-12-18(23)25/h1-16H2,(H2,20,21,26) |
| InChIKey | DSUSATXHHXYORL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |