About 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea
3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea (PubChem CID 23348826) has the molecular formula C14H22N4O
and a molecular weight of 262.36 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea.
Molecular Properties
| Compound Name | 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea |
| PubChem CID | 23348826 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea |
| SMILES | CCc1cc(C)c(N(CC)C(=O)N=C(N)N)c(C)c1 |
| InChI | InChI=1S/C14H22N4O/c1-5-11-7-9(3)12(10(4)8-11)18(6-2)14(19)17-13(15)16/h7-8H,5-6H2,1-4H3,(H4,15,16,17,19) |
| InChIKey | PKIYYDDMMDGKEB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea?
The IUPAC name of 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea (CID 23348826) is 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea.
What is the SMILES notation for 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea?
The canonical SMILES for 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea is CCc1cc(C)c(N(CC)C(=O)N=C(N)N)c(C)c1.
What is the InChIKey of 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea?
The InChIKey is PKIYYDDMMDGKEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O/c1-5-11-7-9(3)12(10(4)8-11)18(6-2)14(19)17-13(15)16/h7-8H,5-6H2,1-4H3,(H4,15,16,17,19).
What are the key properties of 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea?
3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea has a molecular weight of 262.36 g/mol, XLogP of 2.09, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diaminomethylidene)-1-ethyl-1-(4-ethyl-2,6-dimethylphenyl)urea is sourced from PubChem (CID 23348826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).