C12H18ClN5 — CID 23348887
2-(4-chloro-2,6-diethylphenyl)-1-(diaminomethylidene)guanidine (PubChem CID 23348887) has the molecular formula C12H18ClN5 and a molecular weight of 267.76 g/mol. Its IUPAC name is 2-(4-chloro-2,6-diethylphenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(4-chloro-2,6-diethylphenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 23348887 |
| Molecular Formula | C12H18ClN5 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-(4-chloro-2,6-diethylphenyl)-1-(diaminomethylidene)guanidine |
| SMILES | CCc1cc(Cl)cc(CC)c1/N=C(/N)N=C(N)N |
| InChI | InChI=1S/C12H18ClN5/c1-3-7-5-9(13)6-8(4-2)10(7)17-12(16)18-11(14)15/h5-6H,3-4H2,1-2H3,(H6,14,15,16,17,18) |
| InChIKey | XFZDQNWCORRAKY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|