C11H16N2O — CID 23348894
1-(4-ethyl-2-methylphenyl)-3-methylurea (PubChem CID 23348894) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-(4-ethyl-2-methylphenyl)-3-methylurea.
| Compound Name | 1-(4-ethyl-2-methylphenyl)-3-methylurea |
|---|---|
| PubChem CID | 23348894 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-(4-ethyl-2-methylphenyl)-3-methylurea |
| SMILES | CCc1ccc(NC(=O)NC)c(C)c1 |
| InChI | InChI=1S/C11H16N2O/c1-4-9-5-6-10(8(2)7-9)13-11(14)12-3/h5-7H,4H2,1-3H3,(H2,12,13,14) |
| InChIKey | DBXJFCUTVAGLBR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |