C16H22N6OS2 — CID 23349216
5-(3,4-dimethyl-2H-1,3-thiazol-2-yl)-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidin-6-one (PubChem CID 23349216) has the molecular formula C16H22N6OS2 and a molecular weight of 378.53 g/mol. Its IUPAC name is 5-(3,4-dimethyl-2H-1,3-thiazol-2-yl)-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-(3,4-dimethyl-2H-1,3-thiazol-2-yl)-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 23349216 |
| Molecular Formula | C16H22N6OS2 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 5-(3,4-dimethyl-2H-1,3-thiazol-2-yl)-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidin-6-one |
| SMILES | CC1=CSC(c2cnc(NCCSCc3nc[nH]c3C)[nH]c2=O)N1C |
| InChI | InChI=1S/C16H22N6OS2/c1-10-7-25-15(22(10)3)12-6-18-16(21-14(12)23)17-4-5-24-8-13-11(2)19-9-20-13/h6-7,9,15H,4-5,8H2,1-3H3,(H,19,20)(H2,17,18,21,23) |
| InChIKey | KRFAZTVWLKQRHI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|