C15H17BrN6OS2 — CID 23349279
5-[(2-bromo-1,3-thiazol-5-yl)methyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidin-6-one (PubChem CID 23349279) has the molecular formula C15H17BrN6OS2 and a molecular weight of 441.38 g/mol. Its IUPAC name is 5-[(2-bromo-1,3-thiazol-5-yl)methyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-[(2-bromo-1,3-thiazol-5-yl)methyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 23349279 |
| Molecular Formula | C15H17BrN6OS2 |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 5-[(2-bromo-1,3-thiazol-5-yl)methyl]-2-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1H-pyrimidin-6-one |
| SMILES | Cc1[nH]cnc1CSCCNc1ncc(Cc2cnc(Br)s2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H17BrN6OS2/c1-9-12(21-8-20-9)7-24-3-2-17-15-19-5-10(13(23)22-15)4-11-6-18-14(16)25-11/h5-6,8H,2-4,7H2,1H3,(H,20,21)(H2,17,19,22,23) |
| InChIKey | TYSOHFDRKFFDQJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|