About 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline
2-(bromomethyl)-3,6,7-trimethoxyquinoxaline (PubChem CID 23349316) has the molecular formula C12H13BrN2O3
and a molecular weight of 313.15 g/mol. Its IUPAC name is 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline.
Molecular Properties
| Compound Name | 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline |
| PubChem CID | 23349316 |
| Molecular Formula | C12H13BrN2O3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline |
| SMILES | COc1cc2nc(CBr)c(OC)nc2cc1OC |
| InChI | InChI=1S/C12H13BrN2O3/c1-16-10-4-7-8(5-11(10)17-2)15-12(18-3)9(6-13)14-7/h4-5H,6H2,1-3H3 |
| InChIKey | MOTRNNWYAOBARW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline?
The IUPAC name of 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline (CID 23349316) is 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline.
What is the SMILES notation for 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline?
The canonical SMILES for 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline is COc1cc2nc(CBr)c(OC)nc2cc1OC.
What is the InChIKey of 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline?
The InChIKey is MOTRNNWYAOBARW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrN2O3/c1-16-10-4-7-8(5-11(10)17-2)15-12(18-3)9(6-13)14-7/h4-5H,6H2,1-3H3.
What are the key properties of 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline?
2-(bromomethyl)-3,6,7-trimethoxyquinoxaline has a molecular weight of 313.15 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-3,6,7-trimethoxyquinoxaline is sourced from PubChem (CID 23349316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).