About 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide
7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide (PubChem CID 23349429) has the molecular formula C10H12BrClN2O
and a molecular weight of 291.58 g/mol. Its IUPAC name is 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide |
| PubChem CID | 23349429 |
| Molecular Formula | C10H12BrClN2O |
| Molecular Weight | 291.58 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide |
| SMILES | Br.CN(C)C1=NCc2ccc(Cl)cc2O1 |
| InChI | InChI=1S/C10H11ClN2O.BrH/c1-13(2)10-12-6-7-3-4-8(11)5-9(7)14-10;/h3-5H,6H2,1-2H3;1H |
| InChIKey | DSOKINXDMZDVTF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.58 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide?
The IUPAC name of 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide (CID 23349429) is 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide.
What is the SMILES notation for 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide?
The canonical SMILES for 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide is Br.CN(C)C1=NCc2ccc(Cl)cc2O1.
What is the InChIKey of 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide?
The InChIKey is DSOKINXDMZDVTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2O.BrH/c1-13(2)10-12-6-7-3-4-8(11)5-9(7)14-10;/h3-5H,6H2,1-2H3;1H.
What are the key properties of 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide?
7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide has a molecular weight of 291.58 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N,N-dimethyl-4H-1,3-benzoxazin-2-amine;hydrobromide is sourced from PubChem (CID 23349429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).