C20H16O6 — CID 23349623
8-acetyl-1,6,11-trihydroxy-7,8,9,10-tetrahydrotetracene-5,12-dione (PubChem CID 23349623) has the molecular formula C20H16O6 and a molecular weight of 352.34 g/mol. Its IUPAC name is 8-acetyl-1,6,11-trihydroxy-7,8,9,10-tetrahydrotetracene-5,12-dione.
| Compound Name | 8-acetyl-1,6,11-trihydroxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
|---|---|
| PubChem CID | 23349623 |
| Molecular Formula | C20H16O6 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 8-acetyl-1,6,11-trihydroxy-7,8,9,10-tetrahydrotetracene-5,12-dione |
| SMILES | CC(=O)C1CCc2c(O)c3c(c(O)c2C1)C(=O)c1cccc(O)c1C3=O |
| InChI | InChI=1S/C20H16O6/c1-8(21)9-5-6-10-12(7-9)19(25)15-16(17(10)23)20(26)14-11(18(15)24)3-2-4-13(14)22/h2-4,9,22-23,25H,5-7H2,1H3 |
| InChIKey | KTTBCKVXTWJLIR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|