About 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride
2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride (PubChem CID 23349763) has the molecular formula C16H28Cl2N2
and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride |
| PubChem CID | 23349763 |
| Molecular Formula | C16H28Cl2N2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride |
| SMILES | CN(C)C1CCCCCC1NCc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C16H26N2.2ClH/c1-18(2)16-12-8-4-7-11-15(16)17-13-14-9-5-3-6-10-14;;/h3,5-6,9-10,15-17H,4,7-8,11-13H2,1-2H3;2*1H |
| InChIKey | KRPZISKNTBTSQG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride?
The IUPAC name of 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride (CID 23349763) is 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride.
What is the SMILES notation for 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride?
The canonical SMILES for 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride is CN(C)C1CCCCCC1NCc1ccccc1.Cl.Cl.
What is the InChIKey of 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride?
The InChIKey is KRPZISKNTBTSQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2.2ClH/c1-18(2)16-12-8-4-7-11-15(16)17-13-14-9-5-3-6-10-14;;/h3,5-6,9-10,15-17H,4,7-8,11-13H2,1-2H3;2*1H.
What are the key properties of 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride?
2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride has a molecular weight of 319.32 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-benzyl-1-N,1-N-dimethylcycloheptane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 23349763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).