About [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate
[4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate (PubChem CID 23350041) has the molecular formula C19H21ClN2O4
and a molecular weight of 376.84 g/mol. Its IUPAC name is [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate |
| PubChem CID | 23350041 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1 |
| InChI | InChI=1S/C19H21ClN2O4/c1-13(2)18(24)25-11-19(3,4)16(23)17(22-10-9-21-12-22)26-15-7-5-14(20)6-8-15/h5-10,12,17H,1,11H2,2-4H3 |
| InChIKey | BLVWBBDBSFPVOX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate?
The IUPAC name of [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate (CID 23350041) is [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate.
What is the SMILES notation for [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate?
The canonical SMILES for [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate is C=C(C)C(=O)OCC(C)(C)C(=O)C(Oc1ccc(Cl)cc1)n1ccnc1.
What is the InChIKey of [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate?
The InChIKey is BLVWBBDBSFPVOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN2O4/c1-13(2)18(24)25-11-19(3,4)16(23)17(22-10-9-21-12-22)26-15-7-5-14(20)6-8-15/h5-10,12,17H,1,11H2,2-4H3.
What are the key properties of [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate?
[4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate has a molecular weight of 376.84 g/mol, XLogP of 3.83, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-chlorophenoxy)-4-imidazol-1-yl-2,2-dimethyl-3-oxobutyl] 2-methylprop-2-enoate is sourced from PubChem (CID 23350041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).