C11H12N2O2 — CID 23350175
3,6-diisocyanato-1,5,6-trimethylcyclohexa-1,3-diene (PubChem CID 23350175) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 3,6-diisocyanato-1,5,6-trimethylcyclohexa-1,3-diene.
| Compound Name | 3,6-diisocyanato-1,5,6-trimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 23350175 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 3,6-diisocyanato-1,5,6-trimethylcyclohexa-1,3-diene |
| SMILES | CC1=CC(N=C=O)=CC(C)C1(C)N=C=O |
| InChI | InChI=1S/C11H12N2O2/c1-8-4-10(12-6-14)5-9(2)11(8,3)13-7-15/h4-5,8H,1-3H3 |
| InChIKey | LJDKMNRVYMKWJZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|