About 1-chloro-3-(3,4-dichloroanilino)propan-2-ol
1-chloro-3-(3,4-dichloroanilino)propan-2-ol (PubChem CID 23350203) has the molecular formula C9H10Cl3NO
and a molecular weight of 254.54 g/mol. Its IUPAC name is 1-chloro-3-(3,4-dichloroanilino)propan-2-ol.
Molecular Properties
| Compound Name | 1-chloro-3-(3,4-dichloroanilino)propan-2-ol |
| PubChem CID | 23350203 |
| Molecular Formula | C9H10Cl3NO |
| Molecular Weight | 254.54 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 1-chloro-3-(3,4-dichloroanilino)propan-2-ol |
| SMILES | OC(CCl)CNc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H10Cl3NO/c10-4-7(14)5-13-6-1-2-8(11)9(12)3-6/h1-3,7,13-14H,4-5H2 |
| InChIKey | IPVPWMONHJTJLP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-(3,4-dichloroanilino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-(3,4-dichloroanilino)propan-2-ol?
The IUPAC name of 1-chloro-3-(3,4-dichloroanilino)propan-2-ol (CID 23350203) is 1-chloro-3-(3,4-dichloroanilino)propan-2-ol.
What is the SMILES notation for 1-chloro-3-(3,4-dichloroanilino)propan-2-ol?
The canonical SMILES for 1-chloro-3-(3,4-dichloroanilino)propan-2-ol is OC(CCl)CNc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 1-chloro-3-(3,4-dichloroanilino)propan-2-ol?
The InChIKey is IPVPWMONHJTJLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl3NO/c10-4-7(14)5-13-6-1-2-8(11)9(12)3-6/h1-3,7,13-14H,4-5H2.
What are the key properties of 1-chloro-3-(3,4-dichloroanilino)propan-2-ol?
1-chloro-3-(3,4-dichloroanilino)propan-2-ol has a molecular weight of 254.54 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(3,4-dichloroanilino)propan-2-ol is sourced from PubChem (CID 23350203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).