About 1-bromopyrrolidine-2,5-dione;propan-2-one
1-bromopyrrolidine-2,5-dione;propan-2-one (PubChem CID 23350280) has the molecular formula C7H10BrNO3
and a molecular weight of 236.06 g/mol. Its IUPAC name is 1-bromopyrrolidine-2,5-dione;propan-2-one.
Molecular Properties
| Compound Name | 1-bromopyrrolidine-2,5-dione;propan-2-one |
| PubChem CID | 23350280 |
| Molecular Formula | C7H10BrNO3 |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 1-bromopyrrolidine-2,5-dione;propan-2-one |
| SMILES | CC(C)=O.O=C1CCC(=O)N1Br |
| InChI | InChI=1S/C4H4BrNO2.C3H6O/c5-6-3(7)1-2-4(6)8;1-3(2)4/h1-2H2;1-2H3 |
| InChIKey | ZDQAMLHRAVGXHT-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromopyrrolidine-2,5-dione;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromopyrrolidine-2,5-dione;propan-2-one?
The IUPAC name of 1-bromopyrrolidine-2,5-dione;propan-2-one (CID 23350280) is 1-bromopyrrolidine-2,5-dione;propan-2-one.
What is the SMILES notation for 1-bromopyrrolidine-2,5-dione;propan-2-one?
The canonical SMILES for 1-bromopyrrolidine-2,5-dione;propan-2-one is CC(C)=O.O=C1CCC(=O)N1Br.
What is the InChIKey of 1-bromopyrrolidine-2,5-dione;propan-2-one?
The InChIKey is ZDQAMLHRAVGXHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrNO2.C3H6O/c5-6-3(7)1-2-4(6)8;1-3(2)4/h1-2H2;1-2H3.
What are the key properties of 1-bromopyrrolidine-2,5-dione;propan-2-one?
1-bromopyrrolidine-2,5-dione;propan-2-one has a molecular weight of 236.06 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromopyrrolidine-2,5-dione;propan-2-one is sourced from PubChem (CID 23350280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).