C23H23N2Se2+ — CID 23350320
(2Z)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)penta-2,4-dienylidene]-1,3-benzoselenazole (PubChem CID 23350320) has the molecular formula C23H23N2Se2+ and a molecular weight of 485.37 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)penta-2,4-dienylidene]-1,3-benzoselenazole.
| Compound Name | (2Z)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)penta-2,4-dienylidene]-1,3-benzoselenazole |
|---|---|
| PubChem CID | 23350320 |
| Molecular Formula | C23H23N2Se2+ |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | (2Z)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-1,3-benzoselenazol-3-ium-2-yl)penta-2,4-dienylidene]-1,3-benzoselenazole |
| SMILES | CCN1/C(=C/C=C/C=C/c2[se]c3ccccc3[n+]2CC)[Se]c2ccccc21 |
| InChI | InChI=1S/C23H23N2Se2/c1-3-24-18-12-8-10-14-20(18)26-22(24)16-6-5-7-17-23-25(4-2)19-13-9-11-15-21(19)27-23/h5-17H,3-4H2,1-2H3/q+1 |
| InChIKey | OHWBKNMMEGTVGJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|