C19H18N5S+ — CID 23351833
(1S,2S,3S,9R)-5-imino-12-methyl-3-thiophen-3-yl-12-azoniatricyclo[7.2.1.02,7]dodec-7-ene-4,4,6-tricarbonitrile (PubChem CID 23351833) has the molecular formula C19H18N5S+ and a molecular weight of 348.46 g/mol. Its IUPAC name is (1S,2S,3S,9R)-5-imino-12-methyl-3-thiophen-3-yl-12-azoniatricyclo[7.2.1.02,7]dodec-7-ene-4,4,6-tricarbonitrile.
| Compound Name | (1S,2S,3S,9R)-5-imino-12-methyl-3-thiophen-3-yl-12-azoniatricyclo[7.2.1.02,7]dodec-7-ene-4,4,6-tricarbonitrile |
|---|---|
| PubChem CID | 23351833 |
| Molecular Formula | C19H18N5S+ |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (1S,2S,3S,9R)-5-imino-12-methyl-3-thiophen-3-yl-12-azoniatricyclo[7.2.1.02,7]dodec-7-ene-4,4,6-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C2=C[C@H]3CC[C@@H]([C@H]2[C@H](c2ccsc2)C1(C#N)C#N)[NH+]3C |
| InChI | InChI=1S/C19H17N5S/c1-24-12-2-3-15(24)16-13(6-12)14(7-20)18(23)19(9-21,10-22)17(16)11-4-5-25-8-11/h4-6,8,12,14-17,23H,2-3H2,1H3/p+1/b23-18+/t12-,14?,15+,16+,17+/m1/s1 |
| InChIKey | XIPDBQUCRDRJNX-CCTJJAONSA-O |
| XLogP | 1.64 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|