C14H17N4O2+ — CID 23351887
(1S,2S,6R,7S)-3-amino-5,5-dimethoxy-4-azoniatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile (PubChem CID 23351887) has the molecular formula C14H17N4O2+ and a molecular weight of 273.32 g/mol. Its IUPAC name is (1S,2S,6R,7S)-3-amino-5,5-dimethoxy-4-azoniatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile.
| Compound Name | (1S,2S,6R,7S)-3-amino-5,5-dimethoxy-4-azoniatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 23351887 |
| Molecular Formula | C14H17N4O2+ |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (1S,2S,6R,7S)-3-amino-5,5-dimethoxy-4-azoniatricyclo[5.2.2.02,6]undeca-3,8-diene-2,6-dicarbonitrile |
| SMILES | COC1(OC)[NH+]=C(N)[C@@]2(C#N)[C@@H]3C=C[C@H](CC3)[C@@]12C#N |
| InChI | InChI=1S/C14H16N4O2/c1-19-14(20-2)13(8-16)10-5-3-9(4-6-10)12(13,7-15)11(17)18-14/h3,5,9-10H,4,6H2,1-2H3,(H2,17,18)/p+1/t9-,10-,12-,13-/m1/s1 |
| InChIKey | ZFOQLUDRHRQGCA-FPQZTECRSA-O |
| XLogP | -1.00 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|