About 6-butyl-1H-pyridin-2-one
6-butyl-1H-pyridin-2-one (PubChem CID 23352100) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 6-butyl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 6-butyl-1H-pyridin-2-one |
| PubChem CID | 23352100 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 6-butyl-1H-pyridin-2-one |
| SMILES | CCCCc1cccc(=O)[nH]1 |
| InChI | InChI=1S/C9H13NO/c1-2-3-5-8-6-4-7-9(11)10-8/h4,6-7H,2-3,5H2,1H3,(H,10,11) |
| InChIKey | KPOKLVPNESGKHT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-butyl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-1H-pyridin-2-one?
The IUPAC name of 6-butyl-1H-pyridin-2-one (CID 23352100) is 6-butyl-1H-pyridin-2-one.
What is the SMILES notation for 6-butyl-1H-pyridin-2-one?
The canonical SMILES for 6-butyl-1H-pyridin-2-one is CCCCc1cccc(=O)[nH]1.
What is the InChIKey of 6-butyl-1H-pyridin-2-one?
The InChIKey is KPOKLVPNESGKHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-2-3-5-8-6-4-7-9(11)10-8/h4,6-7H,2-3,5H2,1H3,(H,10,11).
What are the key properties of 6-butyl-1H-pyridin-2-one?
6-butyl-1H-pyridin-2-one has a molecular weight of 151.21 g/mol, XLogP of 1.72, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-1H-pyridin-2-one is sourced from PubChem (CID 23352100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).