C7H4F5NO — CID 23352309
2,2,3,3,3-pentafluoro-1-pyrrol-1-ylpropan-1-one (PubChem CID 23352309) has the molecular formula C7H4F5NO and a molecular weight of 213.11 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-pyrrol-1-ylpropan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-pyrrol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 23352309 |
| Molecular Formula | C7H4F5NO |
| Molecular Weight | 213.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-pyrrol-1-ylpropan-1-one |
| SMILES | O=C(n1cccc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H4F5NO/c8-6(9,7(10,11)12)5(14)13-3-1-2-4-13/h1-4H |
| InChIKey | GPGSQDYSGYXFAG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.11 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|