About methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate
methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate (PubChem CID 23352395) has the molecular formula C14H30O5Si2
and a molecular weight of 334.56 g/mol. Its IUPAC name is methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate.
Molecular Properties
| Compound Name | methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate |
| PubChem CID | 23352395 |
| Molecular Formula | C14H30O5Si2 |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate |
| SMILES | COC(=O)CC(CC(CC=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H30O5Si2/c1-17-14(16)11-13(19-21(5,6)7)10-12(8-9-15)18-20(2,3)4/h9,12-13H,8,10-11H2,1-7H3 |
| InChIKey | ASXPDMAVMCSDRW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate?
The IUPAC name of methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate (CID 23352395) is methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate.
What is the SMILES notation for methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate?
The canonical SMILES for methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate is COC(=O)CC(CC(CC=O)O[Si](C)(C)C)O[Si](C)(C)C.
What is the InChIKey of methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate?
The InChIKey is ASXPDMAVMCSDRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O5Si2/c1-17-14(16)11-13(19-21(5,6)7)10-12(8-9-15)18-20(2,3)4/h9,12-13H,8,10-11H2,1-7H3.
What are the key properties of methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate?
methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate has a molecular weight of 334.56 g/mol, XLogP of 2.97, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-oxo-3,5-bis(trimethylsilyloxy)heptanoate is sourced from PubChem (CID 23352395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).