C30H28ClFO2 — CID 23352397
4-(chloromethyl)-3-(4-fluorophenyl)-1,2-bis(phenylmethoxy)-5-propan-2-ylbenzene (PubChem CID 23352397) has the molecular formula C30H28ClFO2 and a molecular weight of 475.00 g/mol. Its IUPAC name is 4-(chloromethyl)-3-(4-fluorophenyl)-1,2-bis(phenylmethoxy)-5-propan-2-ylbenzene.
| Compound Name | 4-(chloromethyl)-3-(4-fluorophenyl)-1,2-bis(phenylmethoxy)-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 23352397 |
| Molecular Formula | C30H28ClFO2 |
| Molecular Weight | 475.00 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 4-(chloromethyl)-3-(4-fluorophenyl)-1,2-bis(phenylmethoxy)-5-propan-2-ylbenzene |
| SMILES | CC(C)c1cc(OCc2ccccc2)c(OCc2ccccc2)c(-c2ccc(F)cc2)c1CCl |
| InChI | InChI=1S/C30H28ClFO2/c1-21(2)26-17-28(33-19-22-9-5-3-6-10-22)30(34-20-23-11-7-4-8-12-23)29(27(26)18-31)24-13-15-25(32)16-14-24/h3-17,21H,18-20H2,1-2H3 |
| InChIKey | BOZNBYRWPUGVFL-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.00 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|