C30H7BBrF20N — CID 23352830
(4-bromophenyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 23352830) has the molecular formula C30H7BBrF20N and a molecular weight of 852.07 g/mol. Its IUPAC name is (4-bromophenyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | (4-bromophenyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 23352830 |
| Molecular Formula | C30H7BBrF20N |
| Molecular Weight | 852.07 g/mol |
| Exact Mass | 850.95 |
| IUPAC Name | (4-bromophenyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F.[NH3+]c1ccc(Br)cc1 |
| InChI | InChI=1S/C24BF20.C6H6BrN/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;7-5-1-3-6(8)4-2-5/h;1-4H,8H2/q-1;/p+1 |
| InChIKey | QVTZMDKXFYVKTH-UHFFFAOYSA-O |
| XLogP | 7.17 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.07 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|