About 3-chloro-5,6-diethylpyrazine-2-carbonitrile
3-chloro-5,6-diethylpyrazine-2-carbonitrile (PubChem CID 23353213) has the molecular formula C9H10ClN3
and a molecular weight of 195.65 g/mol. Its IUPAC name is 3-chloro-5,6-diethylpyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-chloro-5,6-diethylpyrazine-2-carbonitrile |
| PubChem CID | 23353213 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3-chloro-5,6-diethylpyrazine-2-carbonitrile |
| SMILES | CCc1nc(Cl)c(C#N)nc1CC |
| InChI | InChI=1S/C9H10ClN3/c1-3-6-7(4-2)13-9(10)8(5-11)12-6/h3-4H2,1-2H3 |
| InChIKey | FHYFXVGDENUCRO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-5,6-diethylpyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-5,6-diethylpyrazine-2-carbonitrile?
The IUPAC name of 3-chloro-5,6-diethylpyrazine-2-carbonitrile (CID 23353213) is 3-chloro-5,6-diethylpyrazine-2-carbonitrile.
What is the SMILES notation for 3-chloro-5,6-diethylpyrazine-2-carbonitrile?
The canonical SMILES for 3-chloro-5,6-diethylpyrazine-2-carbonitrile is CCc1nc(Cl)c(C#N)nc1CC.
What is the InChIKey of 3-chloro-5,6-diethylpyrazine-2-carbonitrile?
The InChIKey is FHYFXVGDENUCRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3/c1-3-6-7(4-2)13-9(10)8(5-11)12-6/h3-4H2,1-2H3.
What are the key properties of 3-chloro-5,6-diethylpyrazine-2-carbonitrile?
3-chloro-5,6-diethylpyrazine-2-carbonitrile has a molecular weight of 195.65 g/mol, XLogP of 2.13, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-5,6-diethylpyrazine-2-carbonitrile is sourced from PubChem (CID 23353213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).