About 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one
5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 23354110) has the molecular formula C8H5Cl2N3O3
and a molecular weight of 262.05 g/mol. Its IUPAC name is 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one |
| PubChem CID | 23354110 |
| Molecular Formula | C8H5Cl2N3O3 |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | O=C1Nc2cc(Cl)cc(Cl)c2NC1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5Cl2N3O3/c9-3-1-4(10)6-5(2-3)11-8(14)7(12-6)13(15)16/h1-2,7,12H,(H,11,14) |
| InChIKey | WNNJOKYDUIWKIQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one?
The IUPAC name of 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one (CID 23354110) is 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one.
What is the SMILES notation for 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one?
The canonical SMILES for 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one is O=C1Nc2cc(Cl)cc(Cl)c2NC1[N+](=O)[O-].
What is the InChIKey of 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one?
The InChIKey is WNNJOKYDUIWKIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Cl2N3O3/c9-3-1-4(10)6-5(2-3)11-8(14)7(12-6)13(15)16/h1-2,7,12H,(H,11,14).
What are the key properties of 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one?
5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one has a molecular weight of 262.05 g/mol, XLogP of 1.96, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-3-nitro-3,4-dihydro-1H-quinoxalin-2-one is sourced from PubChem (CID 23354110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).