About 8-chloro-1H-1,5-benzodiazepine-2,3-dione
8-chloro-1H-1,5-benzodiazepine-2,3-dione (PubChem CID 23354162) has the molecular formula C9H5ClN2O2
and a molecular weight of 208.60 g/mol. Its IUPAC name is 8-chloro-1H-1,5-benzodiazepine-2,3-dione.
Molecular Properties
| Compound Name | 8-chloro-1H-1,5-benzodiazepine-2,3-dione |
| PubChem CID | 23354162 |
| Molecular Formula | C9H5ClN2O2 |
| Molecular Weight | 208.60 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 8-chloro-1H-1,5-benzodiazepine-2,3-dione |
| SMILES | O=c1cnc2ccc(Cl)cc2[nH]c1=O |
| InChI | InChI=1S/C9H5ClN2O2/c10-5-1-2-6-7(3-5)12-9(14)8(13)4-11-6/h1-4H,(H,12,13,14) |
| InChIKey | YWPQUDLOWGVQDS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.60 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-1H-1,5-benzodiazepine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1H-1,5-benzodiazepine-2,3-dione?
The IUPAC name of 8-chloro-1H-1,5-benzodiazepine-2,3-dione (CID 23354162) is 8-chloro-1H-1,5-benzodiazepine-2,3-dione.
What is the SMILES notation for 8-chloro-1H-1,5-benzodiazepine-2,3-dione?
The canonical SMILES for 8-chloro-1H-1,5-benzodiazepine-2,3-dione is O=c1cnc2ccc(Cl)cc2[nH]c1=O.
What is the InChIKey of 8-chloro-1H-1,5-benzodiazepine-2,3-dione?
The InChIKey is YWPQUDLOWGVQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClN2O2/c10-5-1-2-6-7(3-5)12-9(14)8(13)4-11-6/h1-4H,(H,12,13,14).
What are the key properties of 8-chloro-1H-1,5-benzodiazepine-2,3-dione?
8-chloro-1H-1,5-benzodiazepine-2,3-dione has a molecular weight of 208.60 g/mol, XLogP of 0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1H-1,5-benzodiazepine-2,3-dione is sourced from PubChem (CID 23354162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).