About 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one
6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one (PubChem CID 23354320) has the molecular formula C8H2Br2N4O5
and a molecular weight of 393.94 g/mol. Its IUPAC name is 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one |
| PubChem CID | 23354320 |
| Molecular Formula | C8H2Br2N4O5 |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 391.84 |
| IUPAC Name | 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one |
| SMILES | O=c1[nH]c2cc(Br)c(Br)c([N+](=O)[O-])c2nc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H2Br2N4O5/c9-2-1-3-5(6(4(2)10)13(16)17)12-7(14(18)19)8(15)11-3/h1H,(H,11,15) |
| InChIKey | VNADUPMPYGYTQE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one?
The IUPAC name of 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one (CID 23354320) is 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one.
What is the SMILES notation for 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one?
The canonical SMILES for 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one is O=c1[nH]c2cc(Br)c(Br)c([N+](=O)[O-])c2nc1[N+](=O)[O-].
What is the InChIKey of 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one?
The InChIKey is VNADUPMPYGYTQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2Br2N4O5/c9-2-1-3-5(6(4(2)10)13(16)17)12-7(14(18)19)8(15)11-3/h1H,(H,11,15).
What are the key properties of 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one?
6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one has a molecular weight of 393.94 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dibromo-3,5-dinitro-1H-quinoxalin-2-one is sourced from PubChem (CID 23354320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).