C10H7Cl2N5O4 — CID 23354380
6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2,3-dicarboxamide (PubChem CID 23354380) has the molecular formula C10H7Cl2N5O4 and a molecular weight of 332.10 g/mol. Its IUPAC name is 6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2,3-dicarboxamide.
| Compound Name | 6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2,3-dicarboxamide |
|---|---|
| PubChem CID | 23354380 |
| Molecular Formula | C10H7Cl2N5O4 |
| Molecular Weight | 332.10 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 6,7-dichloro-5-nitro-1,4-dihydroquinoxaline-2,3-dicarboxamide |
| SMILES | NC(=O)C1=C(C(N)=O)Nc2c(cc(Cl)c(Cl)c2[N+](=O)[O-])N1 |
| InChI | InChI=1S/C10H7Cl2N5O4/c11-2-1-3-5(8(4(2)12)17(20)21)16-7(10(14)19)6(15-3)9(13)18/h1,15-16H,(H2,13,18)(H2,14,19) |
| InChIKey | CEPGFMCADHLSRY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.10 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|