About 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid
4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (PubChem CID 23355130) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| PubChem CID | 23355130 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid |
| SMILES | CC1(C)OCC(CO)N1C(=O)O |
| InChI | InChI=1S/C7H13NO4/c1-7(2)8(6(10)11)5(3-9)4-12-7/h5,9H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | OJPCTMYCKYJMRM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
The IUPAC name of 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid (CID 23355130) is 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid.
What is the SMILES notation for 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
The canonical SMILES for 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid is CC1(C)OCC(CO)N1C(=O)O.
What is the InChIKey of 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
The InChIKey is OJPCTMYCKYJMRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO4/c1-7(2)8(6(10)11)5(3-9)4-12-7/h5,9H,3-4H2,1-2H3,(H,10,11).
What are the key properties of 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid?
4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid has a molecular weight of 175.18 g/mol, XLogP of 0.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylic acid is sourced from PubChem (CID 23355130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).