About N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine
N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine (PubChem CID 2335514) has the molecular formula C22H17ClNO2P
and a molecular weight of 393.81 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
| PubChem CID | 2335514 |
| Molecular Formula | C22H17ClNO2P |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
| SMILES | O=P1(Nc2ccc(Cl)cc2)C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C22H17ClNO2P/c23-19-11-13-20(14-12-19)24-27(25)15-21(17-7-3-1-4-8-17)26-22(16-27)18-9-5-2-6-10-18/h1-16H,(H,24,25) |
| InChIKey | XQJJHBGTNILLEF-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine?
The IUPAC name of N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine (CID 2335514) is N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine.
What is the SMILES notation for N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine?
The canonical SMILES for N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine is O=P1(Nc2ccc(Cl)cc2)C=C(c2ccccc2)OC(c2ccccc2)=C1.
What is the InChIKey of N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine?
The InChIKey is XQJJHBGTNILLEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17ClNO2P/c23-19-11-13-20(14-12-19)24-27(25)15-21(17-7-3-1-4-8-17)26-22(16-27)18-9-5-2-6-10-18/h1-16H,(H,24,25).
What are the key properties of N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine?
N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine has a molecular weight of 393.81 g/mol, XLogP of 7.06, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine is sourced from PubChem (CID 2335514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).