About 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one
4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one (PubChem CID 23355437) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one |
| PubChem CID | 23355437 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)NC1 |
| InChI | InChI=1S/C7H9NO3/c1-2-5(9)4-3-8-7(11)6(4)10/h10H,2-3H2,1H3,(H,8,11) |
| InChIKey | QZQWVFYTFCSQID-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one?
The IUPAC name of 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one (CID 23355437) is 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one?
The canonical SMILES for 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one is CCC(=O)C1=C(O)C(=O)NC1.
What is the InChIKey of 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one?
The InChIKey is QZQWVFYTFCSQID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-2-5(9)4-3-8-7(11)6(4)10/h10H,2-3H2,1H3,(H,8,11).
What are the key properties of 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one?
4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one has a molecular weight of 155.15 g/mol, XLogP of -0.09, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-propanoyl-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 23355437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).