C15H26Si — CID 23355510
trimethyl-(1,2,3-trimethyl-4,5,6,7-tetrahydro-1H-inden-4-yl)silane (PubChem CID 23355510) has the molecular formula C15H26Si and a molecular weight of 234.46 g/mol. Its IUPAC name is trimethyl-(1,2,3-trimethyl-4,5,6,7-tetrahydro-1H-inden-4-yl)silane.
| Compound Name | trimethyl-(1,2,3-trimethyl-4,5,6,7-tetrahydro-1H-inden-4-yl)silane |
|---|---|
| PubChem CID | 23355510 |
| Molecular Formula | C15H26Si |
| Molecular Weight | 234.46 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | trimethyl-(1,2,3-trimethyl-4,5,6,7-tetrahydro-1H-inden-4-yl)silane |
| SMILES | CC1=C(C)C(C)C2=C1C([Si](C)(C)C)CCC2 |
| InChI | InChI=1S/C15H26Si/c1-10-11(2)13-8-7-9-14(16(4,5)6)15(13)12(10)3/h11,14H,7-9H2,1-6H3 |
| InChIKey | PKASPQUZVLHSKN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|