C17H16O — CID 23356045
3,4,4a,12a-tetrahydro-1H-naphtho[2,3-g]isochromene (PubChem CID 23356045) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is 3,4,4a,12a-tetrahydro-1H-naphtho[2,3-g]isochromene.
| Compound Name | 3,4,4a,12a-tetrahydro-1H-naphtho[2,3-g]isochromene |
|---|---|
| PubChem CID | 23356045 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3,4,4a,12a-tetrahydro-1H-naphtho[2,3-g]isochromene |
| SMILES | C1=c2cc3ccccc3cc2=CC2COCCC12 |
| InChI | InChI=1S/C17H16O/c1-2-4-13-8-16-10-17-11-18-6-5-14(17)9-15(16)7-12(13)3-1/h1-4,7-10,14,17H,5-6,11H2 |
| InChIKey | ZAGQXEODWJTNQC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |