methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate

C11H10O5 — CID 23356087

IUPACmethyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate
SMILESCOC(=O)C1CC2=C(CO1)C(=O)C=CC2=O
InChIInChI=1S/C11H10O5/c1-15-11(14)10-4-6-7(5-16-10)9(13)3-2-8(6)12/h2-3,10H,4-5H2,1H3
InChIKeyDZNFUUFEJSIHLO-UHFFFAOYSA-N
MW222.20 g/mol
LogP-0.05
Rot. Bonds1

About methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate

methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate (PubChem CID 23356087) has the molecular formula C11H10O5 and a molecular weight of 222.20 g/mol. Its IUPAC name is methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate.

Molecular Properties

Compound Namemethyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate
PubChem CID23356087
Molecular FormulaC11H10O5
Molecular Weight222.20 g/mol
Exact Mass222.05
IUPAC Namemethyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate
SMILESCOC(=O)C1CC2=C(CO1)C(=O)C=CC2=O
InChIInChI=1S/C11H10O5/c1-15-11(14)10-4-6-7(5-16-10)9(13)3-2-8(6)12/h2-3,10H,4-5H2,1H3
InChIKeyDZNFUUFEJSIHLO-UHFFFAOYSA-N
XLogP-0.05
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.20
LogP ≤ 5-0.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}

Analyze methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate?
The IUPAC name of methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate (CID 23356087) is methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate.
What is the SMILES notation for methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate?
The canonical SMILES for methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate is COC(=O)C1CC2=C(CO1)C(=O)C=CC2=O.
What is the InChIKey of methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate?
The InChIKey is DZNFUUFEJSIHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O5/c1-15-11(14)10-4-6-7(5-16-10)9(13)3-2-8(6)12/h2-3,10H,4-5H2,1H3.
What are the key properties of methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate?
methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate has a molecular weight of 222.20 g/mol, XLogP of -0.05, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5,8-dioxo-3,4-dihydro-1H-isochromene-3-carboxylate is sourced from PubChem (CID 23356087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).