About pyrrolo[1,2-a]pyrazin-8-ylmethanol
pyrrolo[1,2-a]pyrazin-8-ylmethanol (PubChem CID 23356495) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is pyrrolo[1,2-a]pyrazin-8-ylmethanol.
Molecular Properties
| Compound Name | pyrrolo[1,2-a]pyrazin-8-ylmethanol |
| PubChem CID | 23356495 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | pyrrolo[1,2-a]pyrazin-8-ylmethanol |
| SMILES | OCc1ccn2ccncc12 |
| InChI | InChI=1S/C8H8N2O/c11-6-7-1-3-10-4-2-9-5-8(7)10/h1-5,11H,6H2 |
| InChIKey | ZLFAHSRIZMYWOY-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolo[1,2-a]pyrazin-8-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolo[1,2-a]pyrazin-8-ylmethanol?
The IUPAC name of pyrrolo[1,2-a]pyrazin-8-ylmethanol (CID 23356495) is pyrrolo[1,2-a]pyrazin-8-ylmethanol.
What is the SMILES notation for pyrrolo[1,2-a]pyrazin-8-ylmethanol?
The canonical SMILES for pyrrolo[1,2-a]pyrazin-8-ylmethanol is OCc1ccn2ccncc12.
What is the InChIKey of pyrrolo[1,2-a]pyrazin-8-ylmethanol?
The InChIKey is ZLFAHSRIZMYWOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-6-7-1-3-10-4-2-9-5-8(7)10/h1-5,11H,6H2.
What are the key properties of pyrrolo[1,2-a]pyrazin-8-ylmethanol?
pyrrolo[1,2-a]pyrazin-8-ylmethanol has a molecular weight of 148.16 g/mol, XLogP of 0.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolo[1,2-a]pyrazin-8-ylmethanol is sourced from PubChem (CID 23356495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).