About methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine
methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine (PubChem CID 23356746) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine |
| PubChem CID | 23356746 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine |
| SMILES | CN1CCC2(CC1)C/C(=N/O)CO2.COC |
| InChI | InChI=1S/C9H16N2O2.C2H6O/c1-11-4-2-9(3-5-11)6-8(10-12)7-13-9;1-3-2/h12H,2-7H2,1H3;1-2H3/b10-8-; |
| InChIKey | GITVMWNXQCXQCS-DQMXGCRQSA-N |
| XLogP | 0.96 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine?
The IUPAC name of methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine (CID 23356746) is methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine.
What is the SMILES notation for methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine?
The canonical SMILES for methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine is CN1CCC2(CC1)C/C(=N/O)CO2.COC.
What is the InChIKey of methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine?
The InChIKey is GITVMWNXQCXQCS-DQMXGCRQSA-N. The full InChI is InChI=1S/C9H16N2O2.C2H6O/c1-11-4-2-9(3-5-11)6-8(10-12)7-13-9;1-3-2/h12H,2-7H2,1H3;1-2H3/b10-8-;.
What are the key properties of methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine?
methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine has a molecular weight of 230.31 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;(NZ)-N-(8-methyl-1-oxa-8-azaspiro[4.5]decan-3-ylidene)hydroxylamine is sourced from PubChem (CID 23356746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).