About (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate
(2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate (PubChem CID 23356945) has the molecular formula C8H10IO5P
and a molecular weight of 344.04 g/mol. Its IUPAC name is (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate.
Molecular Properties
| Compound Name | (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate |
| PubChem CID | 23356945 |
| Molecular Formula | C8H10IO5P |
| Molecular Weight | 344.04 g/mol |
| Exact Mass | 343.93 |
| IUPAC Name | (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate |
| SMILES | Cc1cc(C)c(I=O)c(OP(=O)(O)O)c1 |
| InChI | InChI=1S/C8H10IO5P/c1-5-3-6(2)8(9-10)7(4-5)14-15(11,12)13/h3-4H,1-2H3,(H2,11,12,13) |
| InChIKey | VPLGBVSHVIWQEC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.04 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate?
The IUPAC name of (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate (CID 23356945) is (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate.
What is the SMILES notation for (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate?
The canonical SMILES for (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate is Cc1cc(C)c(I=O)c(OP(=O)(O)O)c1.
What is the InChIKey of (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate?
The InChIKey is VPLGBVSHVIWQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10IO5P/c1-5-3-6(2)8(9-10)7(4-5)14-15(11,12)13/h3-4H,1-2H3,(H2,11,12,13).
What are the key properties of (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate?
(2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate has a molecular weight of 344.04 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-iodosyl-3,5-dimethylphenyl) dihydrogen phosphate is sourced from PubChem (CID 23356945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).