About 2,4-dibromo-1-iodylbenzene;sulfamide
2,4-dibromo-1-iodylbenzene;sulfamide (PubChem CID 23357008) has the molecular formula C6H7Br2IN2O4S
and a molecular weight of 489.91 g/mol. Its IUPAC name is 2,4-dibromo-1-iodylbenzene;sulfamide.
Molecular Properties
| Compound Name | 2,4-dibromo-1-iodylbenzene;sulfamide |
| PubChem CID | 23357008 |
| Molecular Formula | C6H7Br2IN2O4S |
| Molecular Weight | 489.91 g/mol |
| Exact Mass | 487.75 |
| IUPAC Name | 2,4-dibromo-1-iodylbenzene;sulfamide |
| SMILES | NS(N)(=O)=O.O=I(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C6H3Br2IO2.H4N2O2S/c7-4-1-2-6(9(10)11)5(8)3-4;1-5(2,3)4/h1-3H;(H4,1,2,3,4) |
| InChIKey | WQXGGNJOBOIGOF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 489.91 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromo-1-iodylbenzene;sulfamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-1-iodylbenzene;sulfamide?
The IUPAC name of 2,4-dibromo-1-iodylbenzene;sulfamide (CID 23357008) is 2,4-dibromo-1-iodylbenzene;sulfamide.
What is the SMILES notation for 2,4-dibromo-1-iodylbenzene;sulfamide?
The canonical SMILES for 2,4-dibromo-1-iodylbenzene;sulfamide is NS(N)(=O)=O.O=I(=O)c1ccc(Br)cc1Br.
What is the InChIKey of 2,4-dibromo-1-iodylbenzene;sulfamide?
The InChIKey is WQXGGNJOBOIGOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Br2IO2.H4N2O2S/c7-4-1-2-6(9(10)11)5(8)3-4;1-5(2,3)4/h1-3H;(H4,1,2,3,4).
What are the key properties of 2,4-dibromo-1-iodylbenzene;sulfamide?
2,4-dibromo-1-iodylbenzene;sulfamide has a molecular weight of 489.91 g/mol, XLogP of 1.73, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-1-iodylbenzene;sulfamide is sourced from PubChem (CID 23357008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).