About 2-iodyl-3,5,6-trimethylbenzenesulfonic acid
2-iodyl-3,5,6-trimethylbenzenesulfonic acid (PubChem CID 23357406) has the molecular formula C9H11IO5S
and a molecular weight of 358.15 g/mol. Its IUPAC name is 2-iodyl-3,5,6-trimethylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 2-iodyl-3,5,6-trimethylbenzenesulfonic acid |
| PubChem CID | 23357406 |
| Molecular Formula | C9H11IO5S |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 357.94 |
| IUPAC Name | 2-iodyl-3,5,6-trimethylbenzenesulfonic acid |
| SMILES | Cc1cc(C)c(I(=O)=O)c(S(=O)(=O)O)c1C |
| InChI | InChI=1S/C9H11IO5S/c1-5-4-6(2)8(10(11)12)9(7(5)3)16(13,14)15/h4H,1-3H3,(H,13,14,15) |
| InChIKey | CCIYLWIDIZHQKO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-iodyl-3,5,6-trimethylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodyl-3,5,6-trimethylbenzenesulfonic acid?
The IUPAC name of 2-iodyl-3,5,6-trimethylbenzenesulfonic acid (CID 23357406) is 2-iodyl-3,5,6-trimethylbenzenesulfonic acid.
What is the SMILES notation for 2-iodyl-3,5,6-trimethylbenzenesulfonic acid?
The canonical SMILES for 2-iodyl-3,5,6-trimethylbenzenesulfonic acid is Cc1cc(C)c(I(=O)=O)c(S(=O)(=O)O)c1C.
What is the InChIKey of 2-iodyl-3,5,6-trimethylbenzenesulfonic acid?
The InChIKey is CCIYLWIDIZHQKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11IO5S/c1-5-4-6(2)8(10(11)12)9(7(5)3)16(13,14)15/h4H,1-3H3,(H,13,14,15).
What are the key properties of 2-iodyl-3,5,6-trimethylbenzenesulfonic acid?
2-iodyl-3,5,6-trimethylbenzenesulfonic acid has a molecular weight of 358.15 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodyl-3,5,6-trimethylbenzenesulfonic acid is sourced from PubChem (CID 23357406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).