About [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate
[2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 2335783) has the molecular formula C21H15BrN2O4S
and a molecular weight of 471.33 g/mol. Its IUPAC name is [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
Molecular Properties
| Compound Name | [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| PubChem CID | 2335783 |
| Molecular Formula | C21H15BrN2O4S |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)COC(=O)c4ccc(Br)o4)cc3)sc2c1 |
| InChI | InChI=1S/C21H15BrN2O4S/c1-12-2-7-15-17(10-12)29-20(24-15)13-3-5-14(6-4-13)23-19(25)11-27-21(26)16-8-9-18(22)28-16/h2-10H,11H2,1H3,(H,23,25) |
| InChIKey | FEUSUMOGHXMVBM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate?
The IUPAC name of [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate (CID 2335783) is [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate.
What is the SMILES notation for [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate?
The canonical SMILES for [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate is Cc1ccc2nc(-c3ccc(NC(=O)COC(=O)c4ccc(Br)o4)cc3)sc2c1.
What is the InChIKey of [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate?
The InChIKey is FEUSUMOGHXMVBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15BrN2O4S/c1-12-2-7-15-17(10-12)29-20(24-15)13-3-5-14(6-4-13)23-19(25)11-27-21(26)16-8-9-18(22)28-16/h2-10H,11H2,1H3,(H,23,25).
What are the key properties of [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate?
[2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate has a molecular weight of 471.33 g/mol, XLogP of 5.42, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(6-methyl-1,3-benzothiazol-2-yl)anilino]-2-oxoethyl] 5-bromofuran-2-carboxylate is sourced from PubChem (CID 2335783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).