azanylidyneoxidanium nitrate

N2O4 — CID 23358534

IUPACazanylidyneoxidanium nitrate
SMILESN#[O+].O=[N+]([O-])[O-]
InChIInChI=1S/NO3.NO/c2-1(3)4;1-2/q-1;+1
InChIKeySWINTVPHHIJZJR-UHFFFAOYSA-N
MW92.01 g/mol
LogP-0.34
Rot. Bonds

About azanylidyneoxidanium nitrate

azanylidyneoxidanium nitrate (PubChem CID 23358534) has the molecular formula N2O4 and a molecular weight of 92.01 g/mol. Its IUPAC name is azanylidyneoxidanium nitrate.

Molecular Properties

Compound Nameazanylidyneoxidanium nitrate
PubChem CID23358534
Molecular FormulaN2O4
Molecular Weight92.01 g/mol
Exact Mass91.99
IUPAC Nameazanylidyneoxidanium nitrate
SMILESN#[O+].O=[N+]([O-])[O-]
InChIInChI=1S/NO3.NO/c2-1(3)4;1-2/q-1;+1
InChIKeySWINTVPHHIJZJR-UHFFFAOYSA-N
XLogP-0.34
TPSA109.89 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms6
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 50092.01
LogP ≤ 5-0.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze azanylidyneoxidanium nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azanylidyneoxidanium nitrate?
The IUPAC name of azanylidyneoxidanium nitrate (CID 23358534) is azanylidyneoxidanium nitrate.
What is the SMILES notation for azanylidyneoxidanium nitrate?
The canonical SMILES for azanylidyneoxidanium nitrate is N#[O+].O=[N+]([O-])[O-].
What is the InChIKey of azanylidyneoxidanium nitrate?
The InChIKey is SWINTVPHHIJZJR-UHFFFAOYSA-N. The full InChI is InChI=1S/NO3.NO/c2-1(3)4;1-2/q-1;+1.
What are the key properties of azanylidyneoxidanium nitrate?
azanylidyneoxidanium nitrate has a molecular weight of 92.01 g/mol, XLogP of -0.34, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidyneoxidanium nitrate is sourced from PubChem (CID 23358534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).