5-phenyl-1,3,4-oxadiazole-2-carboxylic acid

C9H6N2O3 — CID 23358687

IUPAC5-phenyl-1,3,4-oxadiazole-2-carboxylic acid
SMILESO=C(O)c1nnc(-c2ccccc2)o1
InChIInChI=1S/C9H6N2O3/c12-9(13)8-11-10-7(14-8)6-4-2-1-3-5-6/h1-5H,(H,12,13)
InChIKeyHCTMDIVCEAEJOQ-UHFFFAOYSA-N
MW190.16 g/mol
LogP1.43
Rot. Bonds2

About 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid

5-phenyl-1,3,4-oxadiazole-2-carboxylic acid (PubChem CID 23358687) has the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. Its IUPAC name is 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid.

Molecular Properties

Compound Name5-phenyl-1,3,4-oxadiazole-2-carboxylic acid
PubChem CID23358687
Molecular FormulaC9H6N2O3
Molecular Weight190.16 g/mol
Exact Mass190.04
IUPAC Name5-phenyl-1,3,4-oxadiazole-2-carboxylic acid
SMILESO=C(O)c1nnc(-c2ccccc2)o1
InChIInChI=1S/C9H6N2O3/c12-9(13)8-11-10-7(14-8)6-4-2-1-3-5-6/h1-5H,(H,12,13)
InChIKeyHCTMDIVCEAEJOQ-UHFFFAOYSA-N
XLogP1.43
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.16
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid?
The IUPAC name of 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid (CID 23358687) is 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid.
What is the SMILES notation for 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid?
The canonical SMILES for 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid is O=C(O)c1nnc(-c2ccccc2)o1.
What is the InChIKey of 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid?
The InChIKey is HCTMDIVCEAEJOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c12-9(13)8-11-10-7(14-8)6-4-2-1-3-5-6/h1-5H,(H,12,13).
What are the key properties of 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid?
5-phenyl-1,3,4-oxadiazole-2-carboxylic acid has a molecular weight of 190.16 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-1,3,4-oxadiazole-2-carboxylic acid is sourced from PubChem (CID 23358687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).