5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid

C8H10N2O3 — CID 23358705

IUPAC5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid
SMILESO=C(O)c1nnc(C2CCCC2)o1
InChIInChI=1S/C8H10N2O3/c11-8(12)7-10-9-6(13-7)5-3-1-2-4-5/h5H,1-4H2,(H,11,12)
InChIKeyVIHLHYDPEOLSSE-UHFFFAOYSA-N
MW182.18 g/mol
LogP1.43
Rot. Bonds2

About 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid

5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid (PubChem CID 23358705) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid.

Molecular Properties

Compound Name5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid
PubChem CID23358705
Molecular FormulaC8H10N2O3
Molecular Weight182.18 g/mol
Exact Mass182.07
IUPAC Name5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid
SMILESO=C(O)c1nnc(C2CCCC2)o1
InChIInChI=1S/C8H10N2O3/c11-8(12)7-10-9-6(13-7)5-3-1-2-4-5/h5H,1-4H2,(H,11,12)
InChIKeyVIHLHYDPEOLSSE-UHFFFAOYSA-N
XLogP1.43
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.18
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid?
The IUPAC name of 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid (CID 23358705) is 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid.
What is the SMILES notation for 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid?
The canonical SMILES for 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid is O=C(O)c1nnc(C2CCCC2)o1.
What is the InChIKey of 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid?
The InChIKey is VIHLHYDPEOLSSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c11-8(12)7-10-9-6(13-7)5-3-1-2-4-5/h5H,1-4H2,(H,11,12).
What are the key properties of 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid?
5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid has a molecular weight of 182.18 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-1,3,4-oxadiazole-2-carboxylic acid is sourced from PubChem (CID 23358705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).