About 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one
5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one (PubChem CID 23359507) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one |
| PubChem CID | 23359507 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one |
| SMILES | C=CCC1(CC=C)CC(CO)NC1=O |
| InChI | InChI=1S/C11H17NO2/c1-3-5-11(6-4-2)7-9(8-13)12-10(11)14/h3-4,9,13H,1-2,5-8H2,(H,12,14) |
| InChIKey | IIEQQIZPYNJADG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one?
The IUPAC name of 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one (CID 23359507) is 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one.
What is the SMILES notation for 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one?
The canonical SMILES for 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one is C=CCC1(CC=C)CC(CO)NC1=O.
What is the InChIKey of 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one?
The InChIKey is IIEQQIZPYNJADG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c1-3-5-11(6-4-2)7-9(8-13)12-10(11)14/h3-4,9,13H,1-2,5-8H2,(H,12,14).
What are the key properties of 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one?
5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one has a molecular weight of 195.26 g/mol, XLogP of 1.01, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-3,3-bis(prop-2-enyl)pyrrolidin-2-one is sourced from PubChem (CID 23359507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).