C18H27NO2 — CID 23360064
3-cyclohexyl-6,6-bis(prop-2-enyl)-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 23360064) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-cyclohexyl-6,6-bis(prop-2-enyl)-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | 3-cyclohexyl-6,6-bis(prop-2-enyl)-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 23360064 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-cyclohexyl-6,6-bis(prop-2-enyl)-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C=CCC1(CC=C)CC2COC(C3CCCCC3)N2C1=O |
| InChI | InChI=1S/C18H27NO2/c1-3-10-18(11-4-2)12-15-13-21-16(19(15)17(18)20)14-8-6-5-7-9-14/h3-4,14-16H,1-2,5-13H2 |
| InChIKey | YNZUCOZQTDUOEY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|