About dimethylsilyl cyanide
dimethylsilyl cyanide (PubChem CID 23361477) has the molecular formula C3H6NSi
and a molecular weight of 84.17 g/mol.
Molecular Properties
| Compound Name | dimethylsilyl cyanide |
| PubChem CID | 23361477 |
| Molecular Formula | C3H6NSi |
| Molecular Weight | 84.17 g/mol |
| Exact Mass | 84.03 |
| IUPAC Name | — |
| SMILES | C[Si](C)C#N |
| InChI | InChI=1S/C3H6NSi/c1-5(2)3-4/h1-2H3 |
| InChIKey | HWTRAUXMIYKXQI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.17 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethylsilyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylsilyl cyanide?
The IUPAC name of dimethylsilyl cyanide (CID 23361477) is not available.
What is the SMILES notation for dimethylsilyl cyanide?
The canonical SMILES for dimethylsilyl cyanide is C[Si](C)C#N.
What is the InChIKey of dimethylsilyl cyanide?
The InChIKey is HWTRAUXMIYKXQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6NSi/c1-5(2)3-4/h1-2H3.
What are the key properties of dimethylsilyl cyanide?
dimethylsilyl cyanide has a molecular weight of 84.17 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylsilyl cyanide is sourced from PubChem (CID 23361477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).