About 3-benzyltriazol-4-amine
3-benzyltriazol-4-amine (PubChem CID 23361771) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 3-benzyltriazol-4-amine.
Molecular Properties
| Compound Name | 3-benzyltriazol-4-amine |
| PubChem CID | 23361771 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3-benzyltriazol-4-amine |
| SMILES | Nc1cnnn1Cc1ccccc1 |
| InChI | InChI=1S/C9H10N4/c10-9-6-11-12-13(9)7-8-4-2-1-3-5-8/h1-6H,7,10H2 |
| InChIKey | QRRQLTWAXIGSDK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-benzyltriazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyltriazol-4-amine?
The IUPAC name of 3-benzyltriazol-4-amine (CID 23361771) is 3-benzyltriazol-4-amine.
What is the SMILES notation for 3-benzyltriazol-4-amine?
The canonical SMILES for 3-benzyltriazol-4-amine is Nc1cnnn1Cc1ccccc1.
What is the InChIKey of 3-benzyltriazol-4-amine?
The InChIKey is QRRQLTWAXIGSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c10-9-6-11-12-13(9)7-8-4-2-1-3-5-8/h1-6H,7,10H2.
What are the key properties of 3-benzyltriazol-4-amine?
3-benzyltriazol-4-amine has a molecular weight of 174.21 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyltriazol-4-amine is sourced from PubChem (CID 23361771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).