About 10H-benzo[d][2,1]benzothiazepine-11-thione
10H-benzo[d][2,1]benzothiazepine-11-thione (PubChem CID 23361988) has the molecular formula C13H9NS2
and a molecular weight of 243.36 g/mol. Its IUPAC name is 10H-benzo[d][2,1]benzothiazepine-11-thione.
Molecular Properties
| Compound Name | 10H-benzo[d][2,1]benzothiazepine-11-thione |
| PubChem CID | 23361988 |
| Molecular Formula | C13H9NS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 10H-benzo[d][2,1]benzothiazepine-11-thione |
| SMILES | S=C1CC=CC2=CSN=c3ccccc3=C12 |
| InChI | InChI=1S/C13H9NS2/c15-12-7-3-4-9-8-16-14-11-6-2-1-5-10(11)13(9)12/h1-6,8H,7H2 |
| InChIKey | XIFSDTXLZVOHRD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 10H-benzo[d][2,1]benzothiazepine-11-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-benzo[d][2,1]benzothiazepine-11-thione?
The IUPAC name of 10H-benzo[d][2,1]benzothiazepine-11-thione (CID 23361988) is 10H-benzo[d][2,1]benzothiazepine-11-thione.
What is the SMILES notation for 10H-benzo[d][2,1]benzothiazepine-11-thione?
The canonical SMILES for 10H-benzo[d][2,1]benzothiazepine-11-thione is S=C1CC=CC2=CSN=c3ccccc3=C12.
What is the InChIKey of 10H-benzo[d][2,1]benzothiazepine-11-thione?
The InChIKey is XIFSDTXLZVOHRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NS2/c15-12-7-3-4-9-8-16-14-11-6-2-1-5-10(11)13(9)12/h1-6,8H,7H2.
What are the key properties of 10H-benzo[d][2,1]benzothiazepine-11-thione?
10H-benzo[d][2,1]benzothiazepine-11-thione has a molecular weight of 243.36 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-benzo[d][2,1]benzothiazepine-11-thione is sourced from PubChem (CID 23361988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).