About N-benzylpyridin-2-amine
N-benzylpyridin-2-amine (PubChem CID 23362) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is N-benzylpyridin-2-amine.
Molecular Properties
| Compound Name | N-benzylpyridin-2-amine |
| PubChem CID | 23362 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N-benzylpyridin-2-amine |
| SMILES | c1ccc(CNc2ccccn2)cc1 |
| InChI | InChI=1S/C12H12N2/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13-12/h1-9H,10H2,(H,13,14) |
| InChIKey | WYHXNQXDQQMTQI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylpyridin-2-amine?
The IUPAC name of N-benzylpyridin-2-amine (CID 23362) is N-benzylpyridin-2-amine.
What is the SMILES notation for N-benzylpyridin-2-amine?
The canonical SMILES for N-benzylpyridin-2-amine is c1ccc(CNc2ccccn2)cc1.
What is the InChIKey of N-benzylpyridin-2-amine?
The InChIKey is WYHXNQXDQQMTQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2/c1-2-6-11(7-3-1)10-14-12-8-4-5-9-13-12/h1-9H,10H2,(H,13,14).
What are the key properties of N-benzylpyridin-2-amine?
N-benzylpyridin-2-amine has a molecular weight of 184.24 g/mol, XLogP of 2.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylpyridin-2-amine is sourced from PubChem (CID 23362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).