About 2-(2,6-diaminoanilino)ethanol
2-(2,6-diaminoanilino)ethanol (PubChem CID 23362032) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 2-(2,6-diaminoanilino)ethanol.
Molecular Properties
| Compound Name | 2-(2,6-diaminoanilino)ethanol |
| PubChem CID | 23362032 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 2-(2,6-diaminoanilino)ethanol |
| SMILES | Nc1cccc(N)c1NCCO |
| InChI | InChI=1S/C8H13N3O/c9-6-2-1-3-7(10)8(6)11-4-5-12/h1-3,11-12H,4-5,9-10H2 |
| InChIKey | QSELFESFENFVTP-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,6-diaminoanilino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,6-diaminoanilino)ethanol?
The IUPAC name of 2-(2,6-diaminoanilino)ethanol (CID 23362032) is 2-(2,6-diaminoanilino)ethanol.
What is the SMILES notation for 2-(2,6-diaminoanilino)ethanol?
The canonical SMILES for 2-(2,6-diaminoanilino)ethanol is Nc1cccc(N)c1NCCO.
What is the InChIKey of 2-(2,6-diaminoanilino)ethanol?
The InChIKey is QSELFESFENFVTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c9-6-2-1-3-7(10)8(6)11-4-5-12/h1-3,11-12H,4-5,9-10H2.
What are the key properties of 2-(2,6-diaminoanilino)ethanol?
2-(2,6-diaminoanilino)ethanol has a molecular weight of 167.21 g/mol, XLogP of 0.26, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,6-diaminoanilino)ethanol is sourced from PubChem (CID 23362032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).