C14H18F3N3O3S — CID 23362918
1,1,1-trifluoro-N-(6-imidazo[1,2-a]pyridin-5-yloxyhexyl)methanesulfonamide (PubChem CID 23362918) has the molecular formula C14H18F3N3O3S and a molecular weight of 365.38 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(6-imidazo[1,2-a]pyridin-5-yloxyhexyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(6-imidazo[1,2-a]pyridin-5-yloxyhexyl)methanesulfonamide |
|---|---|
| PubChem CID | 23362918 |
| Molecular Formula | C14H18F3N3O3S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1,1,1-trifluoro-N-(6-imidazo[1,2-a]pyridin-5-yloxyhexyl)methanesulfonamide |
| SMILES | O=S(=O)(NCCCCCCOc1cccc2nccn12)C(F)(F)F |
| InChI | InChI=1S/C14H18F3N3O3S/c15-14(16,17)24(21,22)19-8-3-1-2-4-11-23-13-7-5-6-12-18-9-10-20(12)13/h5-7,9-10,19H,1-4,8,11H2 |
| InChIKey | KULVKPZXBOSRFY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|